C10H19N5O2 — CID 62664840
2,4-dimethyl-6-[2-(propan-2-ylamino)ethylamino]-1,2,4-triazine-3,5-dione (PubChem CID 62664840) has the molecular formula C10H19N5O2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2,4-dimethyl-6-[2-(propan-2-ylamino)ethylamino]-1,2,4-triazine-3,5-dione.
| Compound Name | 2,4-dimethyl-6-[2-(propan-2-ylamino)ethylamino]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 62664840 |
| Molecular Formula | C10H19N5O2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2,4-dimethyl-6-[2-(propan-2-ylamino)ethylamino]-1,2,4-triazine-3,5-dione |
| SMILES | CC(C)NCCNc1nn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C10H19N5O2/c1-7(2)11-5-6-12-8-9(16)14(3)10(17)15(4)13-8/h7,11H,5-6H2,1-4H3,(H,12,13) |
| InChIKey | FANNKXQXLWAMSG-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|