C13H14N2O3 — CID 62665672
N-(3-cyanopropyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 62665672) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is N-(3-cyanopropyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-(3-cyanopropyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 62665672 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-(3-cyanopropyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | N#CCCCNC(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H14N2O3/c14-5-1-2-6-15-13(16)10-3-4-11-12(9-10)18-8-7-17-11/h3-4,9H,1-2,6-8H2,(H,15,16) |
| InChIKey | BLMINFBUVOBASL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|