C10H11ClN2O2S — CID 62666300
N-(3-amino-3-sulfanylidenepropyl)-3-chloro-4-hydroxybenzamide (PubChem CID 62666300) has the molecular formula C10H11ClN2O2S and a molecular weight of 258.73 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-3-chloro-4-hydroxybenzamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-3-chloro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 62666300 |
| Molecular Formula | C10H11ClN2O2S |
| Molecular Weight | 258.73 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-3-chloro-4-hydroxybenzamide |
| SMILES | NC(=S)CCNC(=O)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C10H11ClN2O2S/c11-7-5-6(1-2-8(7)14)10(15)13-4-3-9(12)16/h1-2,5,14H,3-4H2,(H2,12,16)(H,13,15) |
| InChIKey | SREBYHCARTXATE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.73 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|