C11H13N5 — CID 62671828
3-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]pyrazine-2-carbonitrile (PubChem CID 62671828) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 3-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]pyrazine-2-carbonitrile.
| Compound Name | 3-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 62671828 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 3-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C11H13N5/c12-5-9-11(15-3-2-14-9)16-4-1-8-6-13-7-10(8)16/h2-3,8,10,13H,1,4,6-7H2/t8-,10+/m0/s1 |
| InChIKey | AXBJXBXZKLTBDC-WCBMZHEXSA-N |
| XLogP | 0.15 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |