C9H10N4O2 — CID 62672173
ethyl 2-[(3-cyanopyrazin-2-yl)amino]acetate (PubChem CID 62672173) has the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. Its IUPAC name is ethyl 2-[(3-cyanopyrazin-2-yl)amino]acetate.
| Compound Name | ethyl 2-[(3-cyanopyrazin-2-yl)amino]acetate |
|---|---|
| PubChem CID | 62672173 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | ethyl 2-[(3-cyanopyrazin-2-yl)amino]acetate |
| SMILES | CCOC(=O)CNc1nccnc1C#N |
| InChI | InChI=1S/C9H10N4O2/c1-2-15-8(14)6-13-9-7(5-10)11-3-4-12-9/h3-4H,2,6H2,1H3,(H,12,13) |
| InChIKey | KGCROFUREOVWGA-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |