C9H18N4O2 — CID 62673678
N-(methylcarbamoyl)-2-(2-methylpiperazin-1-yl)acetamide (PubChem CID 62673678) has the molecular formula C9H18N4O2 and a molecular weight of 214.27 g/mol. Its IUPAC name is N-(methylcarbamoyl)-2-(2-methylpiperazin-1-yl)acetamide.
| Compound Name | N-(methylcarbamoyl)-2-(2-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 62673678 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | N-(methylcarbamoyl)-2-(2-methylpiperazin-1-yl)acetamide |
| SMILES | CNC(=O)NC(=O)CN1CCNCC1C |
| InChI | InChI=1S/C9H18N4O2/c1-7-5-11-3-4-13(7)6-8(14)12-9(15)10-2/h7,11H,3-6H2,1-2H3,(H2,10,12,14,15) |
| InChIKey | REBJEUNKDZBUBU-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |