About [3-(4,5-dimethylimidazol-1-yl)pyrazin-2-yl]methanamine
[3-(4,5-dimethylimidazol-1-yl)pyrazin-2-yl]methanamine (PubChem CID 62673763) has the molecular formula C10H13N5
and a molecular weight of 203.25 g/mol. Its IUPAC name is [3-(4,5-dimethylimidazol-1-yl)pyrazin-2-yl]methanamine.
Molecular Properties
| Compound Name | [3-(4,5-dimethylimidazol-1-yl)pyrazin-2-yl]methanamine |
| PubChem CID | 62673763 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | [3-(4,5-dimethylimidazol-1-yl)pyrazin-2-yl]methanamine |
| SMILES | Cc1ncn(-c2nccnc2CN)c1C |
| InChI | InChI=1S/C10H13N5/c1-7-8(2)15(6-14-7)10-9(5-11)12-3-4-13-10/h3-4,6H,5,11H2,1-2H3 |
| InChIKey | NQRDHOPNEUOOJE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(4,5-dimethylimidazol-1-yl)pyrazin-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4,5-dimethylimidazol-1-yl)pyrazin-2-yl]methanamine?
The IUPAC name of [3-(4,5-dimethylimidazol-1-yl)pyrazin-2-yl]methanamine (CID 62673763) is [3-(4,5-dimethylimidazol-1-yl)pyrazin-2-yl]methanamine.
What is the SMILES notation for [3-(4,5-dimethylimidazol-1-yl)pyrazin-2-yl]methanamine?
The canonical SMILES for [3-(4,5-dimethylimidazol-1-yl)pyrazin-2-yl]methanamine is Cc1ncn(-c2nccnc2CN)c1C.
What is the InChIKey of [3-(4,5-dimethylimidazol-1-yl)pyrazin-2-yl]methanamine?
The InChIKey is NQRDHOPNEUOOJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5/c1-7-8(2)15(6-14-7)10-9(5-11)12-3-4-13-10/h3-4,6H,5,11H2,1-2H3.
What are the key properties of [3-(4,5-dimethylimidazol-1-yl)pyrazin-2-yl]methanamine?
[3-(4,5-dimethylimidazol-1-yl)pyrazin-2-yl]methanamine has a molecular weight of 203.25 g/mol, XLogP of 0.74, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4,5-dimethylimidazol-1-yl)pyrazin-2-yl]methanamine is sourced from PubChem (CID 62673763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).