About 5-[(2-methylpiperazin-1-yl)methyl]-1,2,4-oxadiazole
5-[(2-methylpiperazin-1-yl)methyl]-1,2,4-oxadiazole (PubChem CID 62674211) has the molecular formula C8H14N4O
and a molecular weight of 182.23 g/mol. Its IUPAC name is 5-[(2-methylpiperazin-1-yl)methyl]-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 5-[(2-methylpiperazin-1-yl)methyl]-1,2,4-oxadiazole |
| PubChem CID | 62674211 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 5-[(2-methylpiperazin-1-yl)methyl]-1,2,4-oxadiazole |
| SMILES | CC1CNCCN1Cc1ncno1 |
| InChI | InChI=1S/C8H14N4O/c1-7-4-9-2-3-12(7)5-8-10-6-11-13-8/h6-7,9H,2-5H2,1H3 |
| InChIKey | SLTRGDZGXAYOCI-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2-methylpiperazin-1-yl)methyl]-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-methylpiperazin-1-yl)methyl]-1,2,4-oxadiazole?
The IUPAC name of 5-[(2-methylpiperazin-1-yl)methyl]-1,2,4-oxadiazole (CID 62674211) is 5-[(2-methylpiperazin-1-yl)methyl]-1,2,4-oxadiazole.
What is the SMILES notation for 5-[(2-methylpiperazin-1-yl)methyl]-1,2,4-oxadiazole?
The canonical SMILES for 5-[(2-methylpiperazin-1-yl)methyl]-1,2,4-oxadiazole is CC1CNCCN1Cc1ncno1.
What is the InChIKey of 5-[(2-methylpiperazin-1-yl)methyl]-1,2,4-oxadiazole?
The InChIKey is SLTRGDZGXAYOCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O/c1-7-4-9-2-3-12(7)5-8-10-6-11-13-8/h6-7,9H,2-5H2,1H3.
What are the key properties of 5-[(2-methylpiperazin-1-yl)methyl]-1,2,4-oxadiazole?
5-[(2-methylpiperazin-1-yl)methyl]-1,2,4-oxadiazole has a molecular weight of 182.23 g/mol, XLogP of -0.14, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-methylpiperazin-1-yl)methyl]-1,2,4-oxadiazole is sourced from PubChem (CID 62674211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).