C15H28N2O2 — CID 62674573
N-[1-(hydroxymethyl)-3-methylcyclohexyl]-2-piperidin-3-ylacetamide (PubChem CID 62674573) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is N-[1-(hydroxymethyl)-3-methylcyclohexyl]-2-piperidin-3-ylacetamide.
| Compound Name | N-[1-(hydroxymethyl)-3-methylcyclohexyl]-2-piperidin-3-ylacetamide |
|---|---|
| PubChem CID | 62674573 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | N-[1-(hydroxymethyl)-3-methylcyclohexyl]-2-piperidin-3-ylacetamide |
| SMILES | CC1CCCC(CO)(NC(=O)CC2CCCNC2)C1 |
| InChI | InChI=1S/C15H28N2O2/c1-12-4-2-6-15(9-12,11-18)17-14(19)8-13-5-3-7-16-10-13/h12-13,16,18H,2-11H2,1H3,(H,17,19) |
| InChIKey | SFFBAEKZSSGPGA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |