C15H28N4O2 — CID 62676308
N-[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]-2-piperidin-3-ylacetamide (PubChem CID 62676308) has the molecular formula C15H28N4O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is N-[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]-2-piperidin-3-ylacetamide.
| Compound Name | N-[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]-2-piperidin-3-ylacetamide |
|---|---|
| PubChem CID | 62676308 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | N-[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]-2-piperidin-3-ylacetamide |
| SMILES | CNC(=O)CN1CCC(NC(=O)CC2CCCNC2)CC1 |
| InChI | InChI=1S/C15H28N4O2/c1-16-15(21)11-19-7-4-13(5-8-19)18-14(20)9-12-3-2-6-17-10-12/h12-13,17H,2-11H2,1H3,(H,16,21)(H,18,20) |
| InChIKey | RSQUWURRQDPPIO-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |