About 2-(5-amino-1,2,4-triazol-1-yl)ethanol
2-(5-amino-1,2,4-triazol-1-yl)ethanol (PubChem CID 62677329) has the molecular formula C4H8N4O
and a molecular weight of 128.13 g/mol. Its IUPAC name is 2-(5-amino-1,2,4-triazol-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(5-amino-1,2,4-triazol-1-yl)ethanol |
| PubChem CID | 62677329 |
| Molecular Formula | C4H8N4O |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | 2-(5-amino-1,2,4-triazol-1-yl)ethanol |
| SMILES | Nc1ncnn1CCO |
| InChI | InChI=1S/C4H8N4O/c5-4-6-3-7-8(4)1-2-9/h3,9H,1-2H2,(H2,5,6,7) |
| InChIKey | ZKUGDAIEPPGCMR-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(5-amino-1,2,4-triazol-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-amino-1,2,4-triazol-1-yl)ethanol?
The IUPAC name of 2-(5-amino-1,2,4-triazol-1-yl)ethanol (CID 62677329) is 2-(5-amino-1,2,4-triazol-1-yl)ethanol.
What is the SMILES notation for 2-(5-amino-1,2,4-triazol-1-yl)ethanol?
The canonical SMILES for 2-(5-amino-1,2,4-triazol-1-yl)ethanol is Nc1ncnn1CCO.
What is the InChIKey of 2-(5-amino-1,2,4-triazol-1-yl)ethanol?
The InChIKey is ZKUGDAIEPPGCMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4O/c5-4-6-3-7-8(4)1-2-9/h3,9H,1-2H2,(H2,5,6,7).
What are the key properties of 2-(5-amino-1,2,4-triazol-1-yl)ethanol?
2-(5-amino-1,2,4-triazol-1-yl)ethanol has a molecular weight of 128.13 g/mol, XLogP of -1.15, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-amino-1,2,4-triazol-1-yl)ethanol is sourced from PubChem (CID 62677329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).