About 2-[1-(1,2,4-triazol-4-yl)ethyl]aniline
2-[1-(1,2,4-triazol-4-yl)ethyl]aniline (PubChem CID 62677379) has the molecular formula C10H12N4
and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-[1-(1,2,4-triazol-4-yl)ethyl]aniline.
Molecular Properties
| Compound Name | 2-[1-(1,2,4-triazol-4-yl)ethyl]aniline |
| PubChem CID | 62677379 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 2-[1-(1,2,4-triazol-4-yl)ethyl]aniline |
| SMILES | CC(c1ccccc1N)n1cnnc1 |
| InChI | InChI=1S/C10H12N4/c1-8(14-6-12-13-7-14)9-4-2-3-5-10(9)11/h2-8H,11H2,1H3 |
| InChIKey | SPSNRIQCSFCFCU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(1,2,4-triazol-4-yl)ethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(1,2,4-triazol-4-yl)ethyl]aniline?
The IUPAC name of 2-[1-(1,2,4-triazol-4-yl)ethyl]aniline (CID 62677379) is 2-[1-(1,2,4-triazol-4-yl)ethyl]aniline.
What is the SMILES notation for 2-[1-(1,2,4-triazol-4-yl)ethyl]aniline?
The canonical SMILES for 2-[1-(1,2,4-triazol-4-yl)ethyl]aniline is CC(c1ccccc1N)n1cnnc1.
What is the InChIKey of 2-[1-(1,2,4-triazol-4-yl)ethyl]aniline?
The InChIKey is SPSNRIQCSFCFCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4/c1-8(14-6-12-13-7-14)9-4-2-3-5-10(9)11/h2-8H,11H2,1H3.
What are the key properties of 2-[1-(1,2,4-triazol-4-yl)ethyl]aniline?
2-[1-(1,2,4-triazol-4-yl)ethyl]aniline has a molecular weight of 188.23 g/mol, XLogP of 1.47, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(1,2,4-triazol-4-yl)ethyl]aniline is sourced from PubChem (CID 62677379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).