About 2-butyl-5-propyl-1,2,4-triazol-3-amine
2-butyl-5-propyl-1,2,4-triazol-3-amine (PubChem CID 62677531) has the molecular formula C9H18N4
and a molecular weight of 182.27 g/mol. Its IUPAC name is 2-butyl-5-propyl-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 2-butyl-5-propyl-1,2,4-triazol-3-amine |
| PubChem CID | 62677531 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 2-butyl-5-propyl-1,2,4-triazol-3-amine |
| SMILES | CCCCn1nc(CCC)nc1N |
| InChI | InChI=1S/C9H18N4/c1-3-5-7-13-9(10)11-8(12-13)6-4-2/h3-7H2,1-2H3,(H2,10,11,12) |
| InChIKey | GSYLRLKUCHYHIG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-butyl-5-propyl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-5-propyl-1,2,4-triazol-3-amine?
The IUPAC name of 2-butyl-5-propyl-1,2,4-triazol-3-amine (CID 62677531) is 2-butyl-5-propyl-1,2,4-triazol-3-amine.
What is the SMILES notation for 2-butyl-5-propyl-1,2,4-triazol-3-amine?
The canonical SMILES for 2-butyl-5-propyl-1,2,4-triazol-3-amine is CCCCn1nc(CCC)nc1N.
What is the InChIKey of 2-butyl-5-propyl-1,2,4-triazol-3-amine?
The InChIKey is GSYLRLKUCHYHIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4/c1-3-5-7-13-9(10)11-8(12-13)6-4-2/h3-7H2,1-2H3,(H2,10,11,12).
What are the key properties of 2-butyl-5-propyl-1,2,4-triazol-3-amine?
2-butyl-5-propyl-1,2,4-triazol-3-amine has a molecular weight of 182.27 g/mol, XLogP of 1.61, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-5-propyl-1,2,4-triazol-3-amine is sourced from PubChem (CID 62677531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).