About 6-(1-amino-2,2-dimethylbutyl)-3-ethyl-1,3-benzoxazol-2-one
6-(1-amino-2,2-dimethylbutyl)-3-ethyl-1,3-benzoxazol-2-one (PubChem CID 62677655) has the molecular formula C15H22N2O2
and a molecular weight of 262.35 g/mol. Its IUPAC name is 6-(1-amino-2,2-dimethylbutyl)-3-ethyl-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 6-(1-amino-2,2-dimethylbutyl)-3-ethyl-1,3-benzoxazol-2-one |
| PubChem CID | 62677655 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 6-(1-amino-2,2-dimethylbutyl)-3-ethyl-1,3-benzoxazol-2-one |
| SMILES | CCn1c(=O)oc2cc(C(N)C(C)(C)CC)ccc21 |
| InChI | InChI=1S/C15H22N2O2/c1-5-15(3,4)13(16)10-7-8-11-12(9-10)19-14(18)17(11)6-2/h7-9,13H,5-6,16H2,1-4H3 |
| InChIKey | JCNUCYOKVXZFDB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 61.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(1-amino-2,2-dimethylbutyl)-3-ethyl-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-amino-2,2-dimethylbutyl)-3-ethyl-1,3-benzoxazol-2-one?
The IUPAC name of 6-(1-amino-2,2-dimethylbutyl)-3-ethyl-1,3-benzoxazol-2-one (CID 62677655) is 6-(1-amino-2,2-dimethylbutyl)-3-ethyl-1,3-benzoxazol-2-one.
What is the SMILES notation for 6-(1-amino-2,2-dimethylbutyl)-3-ethyl-1,3-benzoxazol-2-one?
The canonical SMILES for 6-(1-amino-2,2-dimethylbutyl)-3-ethyl-1,3-benzoxazol-2-one is CCn1c(=O)oc2cc(C(N)C(C)(C)CC)ccc21.
What is the InChIKey of 6-(1-amino-2,2-dimethylbutyl)-3-ethyl-1,3-benzoxazol-2-one?
The InChIKey is JCNUCYOKVXZFDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2/c1-5-15(3,4)13(16)10-7-8-11-12(9-10)19-14(18)17(11)6-2/h7-9,13H,5-6,16H2,1-4H3.
What are the key properties of 6-(1-amino-2,2-dimethylbutyl)-3-ethyl-1,3-benzoxazol-2-one?
6-(1-amino-2,2-dimethylbutyl)-3-ethyl-1,3-benzoxazol-2-one has a molecular weight of 262.35 g/mol, XLogP of 3.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-amino-2,2-dimethylbutyl)-3-ethyl-1,3-benzoxazol-2-one is sourced from PubChem (CID 62677655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).