About 1-(5-ethylfuran-2-yl)-2,2-dimethylbutan-1-amine
1-(5-ethylfuran-2-yl)-2,2-dimethylbutan-1-amine (PubChem CID 62678424) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-(5-ethylfuran-2-yl)-2,2-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 1-(5-ethylfuran-2-yl)-2,2-dimethylbutan-1-amine |
| PubChem CID | 62678424 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 1-(5-ethylfuran-2-yl)-2,2-dimethylbutan-1-amine |
| SMILES | CCc1ccc(C(N)C(C)(C)CC)o1 |
| InChI | InChI=1S/C12H21NO/c1-5-9-7-8-10(14-9)11(13)12(3,4)6-2/h7-8,11H,5-6,13H2,1-4H3 |
| InChIKey | CNHGRMKZYXEOQR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5-ethylfuran-2-yl)-2,2-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-ethylfuran-2-yl)-2,2-dimethylbutan-1-amine?
The IUPAC name of 1-(5-ethylfuran-2-yl)-2,2-dimethylbutan-1-amine (CID 62678424) is 1-(5-ethylfuran-2-yl)-2,2-dimethylbutan-1-amine.
What is the SMILES notation for 1-(5-ethylfuran-2-yl)-2,2-dimethylbutan-1-amine?
The canonical SMILES for 1-(5-ethylfuran-2-yl)-2,2-dimethylbutan-1-amine is CCc1ccc(C(N)C(C)(C)CC)o1.
What is the InChIKey of 1-(5-ethylfuran-2-yl)-2,2-dimethylbutan-1-amine?
The InChIKey is CNHGRMKZYXEOQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-5-9-7-8-10(14-9)11(13)12(3,4)6-2/h7-8,11H,5-6,13H2,1-4H3.
What are the key properties of 1-(5-ethylfuran-2-yl)-2,2-dimethylbutan-1-amine?
1-(5-ethylfuran-2-yl)-2,2-dimethylbutan-1-amine has a molecular weight of 195.31 g/mol, XLogP of 3.28, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-ethylfuran-2-yl)-2,2-dimethylbutan-1-amine is sourced from PubChem (CID 62678424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).