C14H17FN2O3 — CID 62682342
(2,6-dimethylpiperidin-1-yl)-(3-fluoro-4-nitrophenyl)methanone (PubChem CID 62682342) has the molecular formula C14H17FN2O3 and a molecular weight of 280.30 g/mol. Its IUPAC name is (2,6-dimethylpiperidin-1-yl)-(3-fluoro-4-nitrophenyl)methanone.
| Compound Name | (2,6-dimethylpiperidin-1-yl)-(3-fluoro-4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 62682342 |
| Molecular Formula | C14H17FN2O3 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (2,6-dimethylpiperidin-1-yl)-(3-fluoro-4-nitrophenyl)methanone |
| SMILES | CC1CCCC(C)N1C(=O)c1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C14H17FN2O3/c1-9-4-3-5-10(2)16(9)14(18)11-6-7-13(17(19)20)12(15)8-11/h6-10H,3-5H2,1-2H3 |
| InChIKey | CZLQFJSHBKURPX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|