C25H23N3O7 — CID 6268240
[4-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-propoxybenzoate (PubChem CID 6268240) has the molecular formula C25H23N3O7 and a molecular weight of 477.47 g/mol. Its IUPAC name is [4-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-propoxybenzoate.
| Compound Name | [4-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-propoxybenzoate |
|---|---|
| PubChem CID | 6268240 |
| Molecular Formula | C25H23N3O7 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | [4-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)Oc2ccc(/C=N\NC(=O)COc3ccccc3[N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C25H23N3O7/c1-2-15-33-20-13-9-19(10-14-20)25(30)35-21-11-7-18(8-12-21)16-26-27-24(29)17-34-23-6-4-3-5-22(23)28(31)32/h3-14,16H,2,15,17H2,1H3,(H,27,29)/b26-16- |
| InChIKey | RJJJTRTVZVIEOQ-QQXSKIMKSA-N |
| XLogP | 4.13 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|