C15H23N5S — CID 62683600
3-(4-piperidin-1-ylpiperidin-1-yl)pyrazine-2-carbothioamide (PubChem CID 62683600) has the molecular formula C15H23N5S and a molecular weight of 305.45 g/mol. Its IUPAC name is 3-(4-piperidin-1-ylpiperidin-1-yl)pyrazine-2-carbothioamide.
| Compound Name | 3-(4-piperidin-1-ylpiperidin-1-yl)pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 62683600 |
| Molecular Formula | C15H23N5S |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 3-(4-piperidin-1-ylpiperidin-1-yl)pyrazine-2-carbothioamide |
| SMILES | NC(=S)c1nccnc1N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C15H23N5S/c16-14(21)13-15(18-7-6-17-13)20-10-4-12(5-11-20)19-8-2-1-3-9-19/h6-7,12H,1-5,8-11H2,(H2,16,21) |
| InChIKey | UHRWAAPOLBJBAJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|