C12H14N6 — CID 62684033
3-[methyl(pyridin-3-ylmethyl)amino]pyrazine-2-carboximidamide (PubChem CID 62684033) has the molecular formula C12H14N6 and a molecular weight of 242.29 g/mol. Its IUPAC name is 3-[methyl(pyridin-3-ylmethyl)amino]pyrazine-2-carboximidamide.
| Compound Name | 3-[methyl(pyridin-3-ylmethyl)amino]pyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 62684033 |
| Molecular Formula | C12H14N6 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 3-[methyl(pyridin-3-ylmethyl)amino]pyrazine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1nccnc1N(C)Cc1cccnc1 |
| InChI | InChI=1S/C12H14N6/c1-18(8-9-3-2-4-15-7-9)12-10(11(13)14)16-5-6-17-12/h2-7H,8H2,1H3,(H3,13,14) |
| InChIKey | TVMQOEXTBLSWPD-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|