C13H15N7S — CID 62685597
3-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]pyrazine-2-carboximidamide (PubChem CID 62685597) has the molecular formula C13H15N7S and a molecular weight of 301.38 g/mol. Its IUPAC name is 3-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]pyrazine-2-carboximidamide.
| Compound Name | 3-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]pyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 62685597 |
| Molecular Formula | C13H15N7S |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 3-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]pyrazine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1nccnc1Sc1nnc(C2CC2)n1C1CC1 |
| InChI | InChI=1S/C13H15N7S/c14-10(15)9-12(17-6-5-16-9)21-13-19-18-11(7-1-2-7)20(13)8-3-4-8/h5-8H,1-4H2,(H3,14,15) |
| InChIKey | FXFOYKBFAWRHSU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|