C11H10N4O4 — CID 62686184
methyl 3-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]benzoate (PubChem CID 62686184) has the molecular formula C11H10N4O4 and a molecular weight of 262.23 g/mol. Its IUPAC name is methyl 3-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]benzoate.
| Compound Name | methyl 3-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 62686184 |
| Molecular Formula | C11H10N4O4 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | methyl 3-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2nonc2N)c1 |
| InChI | InChI=1S/C11H10N4O4/c1-18-11(17)6-3-2-4-7(5-6)13-10(16)8-9(12)15-19-14-8/h2-5H,1H3,(H2,12,15)(H,13,16) |
| InChIKey | KWNQTPJACGYZNZ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |