methyl 3-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]benzoate

C11H10N4O4 — CID 62686184

IUPACmethyl 3-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]benzoate
SMILESCOC(=O)c1cccc(NC(=O)c2nonc2N)c1
InChIInChI=1S/C11H10N4O4/c1-18-11(17)6-3-2-4-7(5-6)13-10(16)8-9(12)15-19-14-8/h2-5H,1H3,(H2,12,15)(H,13,16)
InChIKeyKWNQTPJACGYZNZ-UHFFFAOYSA-N
MW262.23 g/mol
LogP0.69
Rot. Bonds3

About methyl 3-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]benzoate

methyl 3-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]benzoate (PubChem CID 62686184) has the molecular formula C11H10N4O4 and a molecular weight of 262.23 g/mol. Its IUPAC name is methyl 3-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]benzoate.

Molecular Properties

Compound Namemethyl 3-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]benzoate
PubChem CID62686184
Molecular FormulaC11H10N4O4
Molecular Weight262.23 g/mol
Exact Mass262.07
IUPAC Namemethyl 3-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]benzoate
SMILESCOC(=O)c1cccc(NC(=O)c2nonc2N)c1
InChIInChI=1S/C11H10N4O4/c1-18-11(17)6-3-2-4-7(5-6)13-10(16)8-9(12)15-19-14-8/h2-5H,1H3,(H2,12,15)(H,13,16)
InChIKeyKWNQTPJACGYZNZ-UHFFFAOYSA-N
XLogP0.69
TPSA120.34 Ų
H-Bond Donors2
H-Bond Acceptors7
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.23
LogP ≤ 50.69
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 107

Analyze methyl 3-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]benzoate?
The IUPAC name of methyl 3-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]benzoate (CID 62686184) is methyl 3-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]benzoate.
What is the SMILES notation for methyl 3-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]benzoate?
The canonical SMILES for methyl 3-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]benzoate is COC(=O)c1cccc(NC(=O)c2nonc2N)c1.
What is the InChIKey of methyl 3-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]benzoate?
The InChIKey is KWNQTPJACGYZNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O4/c1-18-11(17)6-3-2-4-7(5-6)13-10(16)8-9(12)15-19-14-8/h2-5H,1H3,(H2,12,15)(H,13,16).
What are the key properties of methyl 3-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]benzoate?
methyl 3-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]benzoate has a molecular weight of 262.23 g/mol, XLogP of 0.69, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]benzoate is sourced from PubChem (CID 62686184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).