About N'-(1,3-dioxan-4-ylmethyl)-N'-methylethane-1,2-diamine
N'-(1,3-dioxan-4-ylmethyl)-N'-methylethane-1,2-diamine (PubChem CID 62687012) has the molecular formula C8H18N2O2
and a molecular weight of 174.24 g/mol. Its IUPAC name is N'-(1,3-dioxan-4-ylmethyl)-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(1,3-dioxan-4-ylmethyl)-N'-methylethane-1,2-diamine |
| PubChem CID | 62687012 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | N'-(1,3-dioxan-4-ylmethyl)-N'-methylethane-1,2-diamine |
| SMILES | CN(CCN)CC1CCOCO1 |
| InChI | InChI=1S/C8H18N2O2/c1-10(4-3-9)6-8-2-5-11-7-12-8/h8H,2-7,9H2,1H3 |
| InChIKey | KSKOAHCZAXTOQG-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(1,3-dioxan-4-ylmethyl)-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1,3-dioxan-4-ylmethyl)-N'-methylethane-1,2-diamine?
The IUPAC name of N'-(1,3-dioxan-4-ylmethyl)-N'-methylethane-1,2-diamine (CID 62687012) is N'-(1,3-dioxan-4-ylmethyl)-N'-methylethane-1,2-diamine.
What is the SMILES notation for N'-(1,3-dioxan-4-ylmethyl)-N'-methylethane-1,2-diamine?
The canonical SMILES for N'-(1,3-dioxan-4-ylmethyl)-N'-methylethane-1,2-diamine is CN(CCN)CC1CCOCO1.
What is the InChIKey of N'-(1,3-dioxan-4-ylmethyl)-N'-methylethane-1,2-diamine?
The InChIKey is KSKOAHCZAXTOQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2/c1-10(4-3-9)6-8-2-5-11-7-12-8/h8H,2-7,9H2,1H3.
What are the key properties of N'-(1,3-dioxan-4-ylmethyl)-N'-methylethane-1,2-diamine?
N'-(1,3-dioxan-4-ylmethyl)-N'-methylethane-1,2-diamine has a molecular weight of 174.24 g/mol, XLogP of -0.36, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1,3-dioxan-4-ylmethyl)-N'-methylethane-1,2-diamine is sourced from PubChem (CID 62687012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).