About 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]acetic acid
2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]acetic acid (PubChem CID 62687089) has the molecular formula C5H6N4O4
and a molecular weight of 186.13 g/mol. Its IUPAC name is 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]acetic acid |
| PubChem CID | 62687089 |
| Molecular Formula | C5H6N4O4 |
| Molecular Weight | 186.13 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]acetic acid |
| SMILES | Nc1nonc1C(=O)NCC(=O)O |
| InChI | InChI=1S/C5H6N4O4/c6-4-3(8-13-9-4)5(12)7-1-2(10)11/h1H2,(H2,6,9)(H,7,12)(H,10,11) |
| InChIKey | ZLRSDSKEDPRKPR-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.13 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]acetic acid?
The IUPAC name of 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]acetic acid (CID 62687089) is 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]acetic acid.
What is the SMILES notation for 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]acetic acid?
The canonical SMILES for 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]acetic acid is Nc1nonc1C(=O)NCC(=O)O.
What is the InChIKey of 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]acetic acid?
The InChIKey is ZLRSDSKEDPRKPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4O4/c6-4-3(8-13-9-4)5(12)7-1-2(10)11/h1H2,(H2,6,9)(H,7,12)(H,10,11).
What are the key properties of 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]acetic acid?
2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]acetic acid has a molecular weight of 186.13 g/mol, XLogP of -1.53, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]acetic acid is sourced from PubChem (CID 62687089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).