About 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-methylamino]acetic acid
2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-methylamino]acetic acid (PubChem CID 62687453) has the molecular formula C6H8N4O4
and a molecular weight of 200.15 g/mol. Its IUPAC name is 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-methylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-methylamino]acetic acid |
| PubChem CID | 62687453 |
| Molecular Formula | C6H8N4O4 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)c1nonc1N |
| InChI | InChI=1S/C6H8N4O4/c1-10(2-3(11)12)6(13)4-5(7)9-14-8-4/h2H2,1H3,(H2,7,9)(H,11,12) |
| InChIKey | KZHWYIDRJULRSY-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-methylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-methylamino]acetic acid?
The IUPAC name of 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-methylamino]acetic acid (CID 62687453) is 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-methylamino]acetic acid.
What is the SMILES notation for 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-methylamino]acetic acid?
The canonical SMILES for 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-methylamino]acetic acid is CN(CC(=O)O)C(=O)c1nonc1N.
What is the InChIKey of 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-methylamino]acetic acid?
The InChIKey is KZHWYIDRJULRSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O4/c1-10(2-3(11)12)6(13)4-5(7)9-14-8-4/h2H2,1H3,(H2,7,9)(H,11,12).
What are the key properties of 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-methylamino]acetic acid?
2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-methylamino]acetic acid has a molecular weight of 200.15 g/mol, XLogP of -1.19, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-methylamino]acetic acid is sourced from PubChem (CID 62687453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).