About (4-amino-1,2,5-oxadiazol-3-yl)-(4-prop-2-enylpiperazin-1-yl)methanone
(4-amino-1,2,5-oxadiazol-3-yl)-(4-prop-2-enylpiperazin-1-yl)methanone (PubChem CID 62687829) has the molecular formula C10H15N5O2
and a molecular weight of 237.26 g/mol. Its IUPAC name is (4-amino-1,2,5-oxadiazol-3-yl)-(4-prop-2-enylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | (4-amino-1,2,5-oxadiazol-3-yl)-(4-prop-2-enylpiperazin-1-yl)methanone |
| PubChem CID | 62687829 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (4-amino-1,2,5-oxadiazol-3-yl)-(4-prop-2-enylpiperazin-1-yl)methanone |
| SMILES | C=CCN1CCN(C(=O)c2nonc2N)CC1 |
| InChI | InChI=1S/C10H15N5O2/c1-2-3-14-4-6-15(7-5-14)10(16)8-9(11)13-17-12-8/h2H,1,3-7H2,(H2,11,13) |
| InChIKey | UNAMKEMFMVQQEI-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-1,2,5-oxadiazol-3-yl)-(4-prop-2-enylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-1,2,5-oxadiazol-3-yl)-(4-prop-2-enylpiperazin-1-yl)methanone?
The IUPAC name of (4-amino-1,2,5-oxadiazol-3-yl)-(4-prop-2-enylpiperazin-1-yl)methanone (CID 62687829) is (4-amino-1,2,5-oxadiazol-3-yl)-(4-prop-2-enylpiperazin-1-yl)methanone.
What is the SMILES notation for (4-amino-1,2,5-oxadiazol-3-yl)-(4-prop-2-enylpiperazin-1-yl)methanone?
The canonical SMILES for (4-amino-1,2,5-oxadiazol-3-yl)-(4-prop-2-enylpiperazin-1-yl)methanone is C=CCN1CCN(C(=O)c2nonc2N)CC1.
What is the InChIKey of (4-amino-1,2,5-oxadiazol-3-yl)-(4-prop-2-enylpiperazin-1-yl)methanone?
The InChIKey is UNAMKEMFMVQQEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5O2/c1-2-3-14-4-6-15(7-5-14)10(16)8-9(11)13-17-12-8/h2H,1,3-7H2,(H2,11,13).
What are the key properties of (4-amino-1,2,5-oxadiazol-3-yl)-(4-prop-2-enylpiperazin-1-yl)methanone?
(4-amino-1,2,5-oxadiazol-3-yl)-(4-prop-2-enylpiperazin-1-yl)methanone has a molecular weight of 237.26 g/mol, XLogP of -0.40, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-1,2,5-oxadiazol-3-yl)-(4-prop-2-enylpiperazin-1-yl)methanone is sourced from PubChem (CID 62687829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).