C20H13BrFN3O2S — CID 6268788
(6Z)-6-[[3-bromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-5-imino-[1,3]thiazolo[3,2-a]pyrimidin-7-one (PubChem CID 6268788) has the molecular formula C20H13BrFN3O2S and a molecular weight of 458.31 g/mol. Its IUPAC name is (6Z)-6-[[3-bromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-5-imino-[1,3]thiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[[3-bromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-5-imino-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 6268788 |
| Molecular Formula | C20H13BrFN3O2S |
| Molecular Weight | 458.31 g/mol |
| Exact Mass | 456.99 |
| IUPAC Name | (6Z)-6-[[3-bromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-5-imino-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2ccc(OCc3ccc(F)cc3)c(Br)c2)/C(=O)N=C2SC=CN2/1 |
| InChI | InChI=1S/C20H13BrFN3O2S/c21-16-10-13(3-6-17(16)27-11-12-1-4-14(22)5-2-12)9-15-18(23)25-7-8-28-20(25)24-19(15)26/h1-10,23H,11H2/b15-9-,23-18- |
| InChIKey | KJNQPDBAFYGIOZ-JKEKRAIHSA-N |
| XLogP | 4.94 |
| TPSA | 65.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.31 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|