C15H26N2O3 — CID 62689102
2-[1-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]piperidin-3-yl]acetic acid (PubChem CID 62689102) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is 2-[1-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[1-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 62689102 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 2-[1-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]piperidin-3-yl]acetic acid |
| SMILES | CC1CCCN(C(=O)CN2CCCC(CC(=O)O)C2)C1 |
| InChI | InChI=1S/C15H26N2O3/c1-12-4-2-7-17(9-12)14(18)11-16-6-3-5-13(10-16)8-15(19)20/h12-13H,2-11H2,1H3,(H,19,20) |
| InChIKey | PYVMZPGVJGYZTL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |