About 2-[1-[2-(2,4-dioxopyrimidin-1-yl)acetyl]piperidin-3-yl]acetic acid
2-[1-[2-(2,4-dioxopyrimidin-1-yl)acetyl]piperidin-3-yl]acetic acid (PubChem CID 62689572) has the molecular formula C13H17N3O5
and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-[1-[2-(2,4-dioxopyrimidin-1-yl)acetyl]piperidin-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[1-[2-(2,4-dioxopyrimidin-1-yl)acetyl]piperidin-3-yl]acetic acid |
| PubChem CID | 62689572 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-[1-[2-(2,4-dioxopyrimidin-1-yl)acetyl]piperidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CCCN(C(=O)Cn2ccc(=O)[nH]c2=O)C1 |
| InChI | InChI=1S/C13H17N3O5/c17-10-3-5-16(13(21)14-10)8-11(18)15-4-1-2-9(7-15)6-12(19)20/h3,5,9H,1-2,4,6-8H2,(H,19,20)(H,14,17,21) |
| InChIKey | FDRMOISYUXQWSN-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-[2-(2,4-dioxopyrimidin-1-yl)acetyl]piperidin-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[2-(2,4-dioxopyrimidin-1-yl)acetyl]piperidin-3-yl]acetic acid?
The IUPAC name of 2-[1-[2-(2,4-dioxopyrimidin-1-yl)acetyl]piperidin-3-yl]acetic acid (CID 62689572) is 2-[1-[2-(2,4-dioxopyrimidin-1-yl)acetyl]piperidin-3-yl]acetic acid.
What is the SMILES notation for 2-[1-[2-(2,4-dioxopyrimidin-1-yl)acetyl]piperidin-3-yl]acetic acid?
The canonical SMILES for 2-[1-[2-(2,4-dioxopyrimidin-1-yl)acetyl]piperidin-3-yl]acetic acid is O=C(O)CC1CCCN(C(=O)Cn2ccc(=O)[nH]c2=O)C1.
What is the InChIKey of 2-[1-[2-(2,4-dioxopyrimidin-1-yl)acetyl]piperidin-3-yl]acetic acid?
The InChIKey is FDRMOISYUXQWSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O5/c17-10-3-5-16(13(21)14-10)8-11(18)15-4-1-2-9(7-15)6-12(19)20/h3,5,9H,1-2,4,6-8H2,(H,19,20)(H,14,17,21).
What are the key properties of 2-[1-[2-(2,4-dioxopyrimidin-1-yl)acetyl]piperidin-3-yl]acetic acid?
2-[1-[2-(2,4-dioxopyrimidin-1-yl)acetyl]piperidin-3-yl]acetic acid has a molecular weight of 295.29 g/mol, XLogP of -0.75, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[2-(2,4-dioxopyrimidin-1-yl)acetyl]piperidin-3-yl]acetic acid is sourced from PubChem (CID 62689572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).