C16H17NO3 — CID 62690231
2-[1-(3-phenylprop-2-ynoyl)piperidin-3-yl]acetic acid (PubChem CID 62690231) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-[1-(3-phenylprop-2-ynoyl)piperidin-3-yl]acetic acid.
| Compound Name | 2-[1-(3-phenylprop-2-ynoyl)piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 62690231 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-[1-(3-phenylprop-2-ynoyl)piperidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CCCN(C(=O)C#Cc2ccccc2)C1 |
| InChI | InChI=1S/C16H17NO3/c18-15(9-8-13-5-2-1-3-6-13)17-10-4-7-14(12-17)11-16(19)20/h1-3,5-6,14H,4,7,10-12H2,(H,19,20) |
| InChIKey | VUMXPSMNOBFERK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|