C13H15ClN2O3 — CID 62690770
2-[1-(6-chloropyridine-2-carbonyl)piperidin-3-yl]acetic acid (PubChem CID 62690770) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is 2-[1-(6-chloropyridine-2-carbonyl)piperidin-3-yl]acetic acid.
| Compound Name | 2-[1-(6-chloropyridine-2-carbonyl)piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 62690770 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-[1-(6-chloropyridine-2-carbonyl)piperidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CCCN(C(=O)c2cccc(Cl)n2)C1 |
| InChI | InChI=1S/C13H15ClN2O3/c14-11-5-1-4-10(15-11)13(19)16-6-2-3-9(8-16)7-12(17)18/h1,4-5,9H,2-3,6-8H2,(H,17,18) |
| InChIKey | QFADYZRNDRAPQW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|