C11H20N2O2S — CID 62691071
1-(1-oxo-1,4-thiazinan-4-yl)-2-piperidin-3-ylethanone (PubChem CID 62691071) has the molecular formula C11H20N2O2S and a molecular weight of 244.36 g/mol. Its IUPAC name is 1-(1-oxo-1,4-thiazinan-4-yl)-2-piperidin-3-ylethanone.
| Compound Name | 1-(1-oxo-1,4-thiazinan-4-yl)-2-piperidin-3-ylethanone |
|---|---|
| PubChem CID | 62691071 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 1-(1-oxo-1,4-thiazinan-4-yl)-2-piperidin-3-ylethanone |
| SMILES | O=C(CC1CCCNC1)N1CCS(=O)CC1 |
| InChI | InChI=1S/C11H20N2O2S/c14-11(8-10-2-1-3-12-9-10)13-4-6-16(15)7-5-13/h10,12H,1-9H2 |
| InChIKey | XNADJYPOLDHDTO-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |