C11H16N2O4S — CID 62691122
2-[1-(1H-pyrrol-3-ylsulfonyl)piperidin-3-yl]acetic acid (PubChem CID 62691122) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-[1-(1H-pyrrol-3-ylsulfonyl)piperidin-3-yl]acetic acid.
| Compound Name | 2-[1-(1H-pyrrol-3-ylsulfonyl)piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 62691122 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-[1-(1H-pyrrol-3-ylsulfonyl)piperidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CCCN(S(=O)(=O)c2cc[nH]c2)C1 |
| InChI | InChI=1S/C11H16N2O4S/c14-11(15)6-9-2-1-5-13(8-9)18(16,17)10-3-4-12-7-10/h3-4,7,9,12H,1-2,5-6,8H2,(H,14,15) |
| InChIKey | OVHDWONGQZNEQZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |