2-[1-(2,3,4,5,6-pentafluorophenyl)piperidin-3-yl]acetic acid

C13H12F5NO2 — CID 62691305

IUPAC2-[1-(2,3,4,5,6-pentafluorophenyl)piperidin-3-yl]acetic acid
SMILESO=C(O)CC1CCCN(c2c(F)c(F)c(F)c(F)c2F)C1
InChIInChI=1S/C13H12F5NO2/c14-8-9(15)11(17)13(12(18)10(8)16)19-3-1-2-6(5-19)4-7(20)21/h6H,1-5H2,(H,20,21)
InChIKeyBHCUPARGUKBHQF-UHFFFAOYSA-N
MW309.23 g/mol
LogP3.07
Rot. Bonds3

About 2-[1-(2,3,4,5,6-pentafluorophenyl)piperidin-3-yl]acetic acid

2-[1-(2,3,4,5,6-pentafluorophenyl)piperidin-3-yl]acetic acid (PubChem CID 62691305) has the molecular formula C13H12F5NO2 and a molecular weight of 309.23 g/mol. Its IUPAC name is 2-[1-(2,3,4,5,6-pentafluorophenyl)piperidin-3-yl]acetic acid.

Molecular Properties

Compound Name2-[1-(2,3,4,5,6-pentafluorophenyl)piperidin-3-yl]acetic acid
PubChem CID62691305
Molecular FormulaC13H12F5NO2
Molecular Weight309.23 g/mol
Exact Mass309.08
IUPAC Name2-[1-(2,3,4,5,6-pentafluorophenyl)piperidin-3-yl]acetic acid
SMILESO=C(O)CC1CCCN(c2c(F)c(F)c(F)c(F)c2F)C1
InChIInChI=1S/C13H12F5NO2/c14-8-9(15)11(17)13(12(18)10(8)16)19-3-1-2-6(5-19)4-7(20)21/h6H,1-5H2,(H,20,21)
InChIKeyBHCUPARGUKBHQF-UHFFFAOYSA-N
XLogP3.07
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.23
LogP ≤ 53.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze 2-[1-(2,3,4,5,6-pentafluorophenyl)piperidin-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(2,3,4,5,6-pentafluorophenyl)piperidin-3-yl]acetic acid?
The IUPAC name of 2-[1-(2,3,4,5,6-pentafluorophenyl)piperidin-3-yl]acetic acid (CID 62691305) is 2-[1-(2,3,4,5,6-pentafluorophenyl)piperidin-3-yl]acetic acid.
What is the SMILES notation for 2-[1-(2,3,4,5,6-pentafluorophenyl)piperidin-3-yl]acetic acid?
The canonical SMILES for 2-[1-(2,3,4,5,6-pentafluorophenyl)piperidin-3-yl]acetic acid is O=C(O)CC1CCCN(c2c(F)c(F)c(F)c(F)c2F)C1.
What is the InChIKey of 2-[1-(2,3,4,5,6-pentafluorophenyl)piperidin-3-yl]acetic acid?
The InChIKey is BHCUPARGUKBHQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F5NO2/c14-8-9(15)11(17)13(12(18)10(8)16)19-3-1-2-6(5-19)4-7(20)21/h6H,1-5H2,(H,20,21).
What are the key properties of 2-[1-(2,3,4,5,6-pentafluorophenyl)piperidin-3-yl]acetic acid?
2-[1-(2,3,4,5,6-pentafluorophenyl)piperidin-3-yl]acetic acid has a molecular weight of 309.23 g/mol, XLogP of 3.07, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,3,4,5,6-pentafluorophenyl)piperidin-3-yl]acetic acid is sourced from PubChem (CID 62691305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).