C13H12F5NO2 — CID 62691305
2-[1-(2,3,4,5,6-pentafluorophenyl)piperidin-3-yl]acetic acid (PubChem CID 62691305) has the molecular formula C13H12F5NO2 and a molecular weight of 309.23 g/mol. Its IUPAC name is 2-[1-(2,3,4,5,6-pentafluorophenyl)piperidin-3-yl]acetic acid.
| Compound Name | 2-[1-(2,3,4,5,6-pentafluorophenyl)piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 62691305 |
| Molecular Formula | C13H12F5NO2 |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2-[1-(2,3,4,5,6-pentafluorophenyl)piperidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CCCN(c2c(F)c(F)c(F)c(F)c2F)C1 |
| InChI | InChI=1S/C13H12F5NO2/c14-8-9(15)11(17)13(12(18)10(8)16)19-3-1-2-6(5-19)4-7(20)21/h6H,1-5H2,(H,20,21) |
| InChIKey | BHCUPARGUKBHQF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|