C12H26N2O2S — CID 62691467
3-N,3-N-bis(2-methylpropyl)-1,1-dioxothiolane-3,4-diamine (PubChem CID 62691467) has the molecular formula C12H26N2O2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 3-N,3-N-bis(2-methylpropyl)-1,1-dioxothiolane-3,4-diamine.
| Compound Name | 3-N,3-N-bis(2-methylpropyl)-1,1-dioxothiolane-3,4-diamine |
|---|---|
| PubChem CID | 62691467 |
| Molecular Formula | C12H26N2O2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3-N,3-N-bis(2-methylpropyl)-1,1-dioxothiolane-3,4-diamine |
| SMILES | CC(C)CN(CC(C)C)C1CS(=O)(=O)CC1N |
| InChI | InChI=1S/C12H26N2O2S/c1-9(2)5-14(6-10(3)4)12-8-17(15,16)7-11(12)13/h9-12H,5-8,13H2,1-4H3 |
| InChIKey | MZWIKIQJZNGZSU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |