About 5-(4-propyl-1,2,4-triazol-3-yl)pentan-1-amine
5-(4-propyl-1,2,4-triazol-3-yl)pentan-1-amine (PubChem CID 62692184) has the molecular formula C10H20N4
and a molecular weight of 196.30 g/mol. Its IUPAC name is 5-(4-propyl-1,2,4-triazol-3-yl)pentan-1-amine.
Molecular Properties
| Compound Name | 5-(4-propyl-1,2,4-triazol-3-yl)pentan-1-amine |
| PubChem CID | 62692184 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 5-(4-propyl-1,2,4-triazol-3-yl)pentan-1-amine |
| SMILES | CCCn1cnnc1CCCCCN |
| InChI | InChI=1S/C10H20N4/c1-2-8-14-9-12-13-10(14)6-4-3-5-7-11/h9H,2-8,11H2,1H3 |
| InChIKey | YOZPMVJAUKOOHQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-propyl-1,2,4-triazol-3-yl)pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-propyl-1,2,4-triazol-3-yl)pentan-1-amine?
The IUPAC name of 5-(4-propyl-1,2,4-triazol-3-yl)pentan-1-amine (CID 62692184) is 5-(4-propyl-1,2,4-triazol-3-yl)pentan-1-amine.
What is the SMILES notation for 5-(4-propyl-1,2,4-triazol-3-yl)pentan-1-amine?
The canonical SMILES for 5-(4-propyl-1,2,4-triazol-3-yl)pentan-1-amine is CCCn1cnnc1CCCCCN.
What is the InChIKey of 5-(4-propyl-1,2,4-triazol-3-yl)pentan-1-amine?
The InChIKey is YOZPMVJAUKOOHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4/c1-2-8-14-9-12-13-10(14)6-4-3-5-7-11/h9H,2-8,11H2,1H3.
What are the key properties of 5-(4-propyl-1,2,4-triazol-3-yl)pentan-1-amine?
5-(4-propyl-1,2,4-triazol-3-yl)pentan-1-amine has a molecular weight of 196.30 g/mol, XLogP of 1.36, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-propyl-1,2,4-triazol-3-yl)pentan-1-amine is sourced from PubChem (CID 62692184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).