About 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidine
3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidine (PubChem CID 62692599) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidine.
Molecular Properties
| Compound Name | 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidine |
| PubChem CID | 62692599 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidine |
| SMILES | Cn1cnnc1CCC1CCCNC1 |
| InChI | InChI=1S/C10H18N4/c1-14-8-12-13-10(14)5-4-9-3-2-6-11-7-9/h8-9,11H,2-7H2,1H3 |
| InChIKey | DZWRUSDFNORUMZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidine?
The IUPAC name of 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidine (CID 62692599) is 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidine.
What is the SMILES notation for 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidine?
The canonical SMILES for 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidine is Cn1cnnc1CCC1CCCNC1.
What is the InChIKey of 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidine?
The InChIKey is DZWRUSDFNORUMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4/c1-14-8-12-13-10(14)5-4-9-3-2-6-11-7-9/h8-9,11H,2-7H2,1H3.
What are the key properties of 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidine?
3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidine has a molecular weight of 194.28 g/mol, XLogP of 0.75, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidine is sourced from PubChem (CID 62692599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).