About 2-(4-ethyl-1,2,4-triazol-3-yl)morpholine
2-(4-ethyl-1,2,4-triazol-3-yl)morpholine (PubChem CID 62692797) has the molecular formula C8H14N4O
and a molecular weight of 182.23 g/mol. Its IUPAC name is 2-(4-ethyl-1,2,4-triazol-3-yl)morpholine.
Molecular Properties
| Compound Name | 2-(4-ethyl-1,2,4-triazol-3-yl)morpholine |
| PubChem CID | 62692797 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 2-(4-ethyl-1,2,4-triazol-3-yl)morpholine |
| SMILES | CCn1cnnc1C1CNCCO1 |
| InChI | InChI=1S/C8H14N4O/c1-2-12-6-10-11-8(12)7-5-9-3-4-13-7/h6-7,9H,2-5H2,1H3 |
| InChIKey | CEOKVHXXLGDCLM-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-ethyl-1,2,4-triazol-3-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethyl-1,2,4-triazol-3-yl)morpholine?
The IUPAC name of 2-(4-ethyl-1,2,4-triazol-3-yl)morpholine (CID 62692797) is 2-(4-ethyl-1,2,4-triazol-3-yl)morpholine.
What is the SMILES notation for 2-(4-ethyl-1,2,4-triazol-3-yl)morpholine?
The canonical SMILES for 2-(4-ethyl-1,2,4-triazol-3-yl)morpholine is CCn1cnnc1C1CNCCO1.
What is the InChIKey of 2-(4-ethyl-1,2,4-triazol-3-yl)morpholine?
The InChIKey is CEOKVHXXLGDCLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O/c1-2-12-6-10-11-8(12)7-5-9-3-4-13-7/h6-7,9H,2-5H2,1H3.
What are the key properties of 2-(4-ethyl-1,2,4-triazol-3-yl)morpholine?
2-(4-ethyl-1,2,4-triazol-3-yl)morpholine has a molecular weight of 182.23 g/mol, XLogP of -0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethyl-1,2,4-triazol-3-yl)morpholine is sourced from PubChem (CID 62692797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).