C9H15N3S — CID 62693645
5-ethyl-6-methyl-2-(methylsulfanylmethyl)pyrimidin-4-amine (PubChem CID 62693645) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is 5-ethyl-6-methyl-2-(methylsulfanylmethyl)pyrimidin-4-amine.
| Compound Name | 5-ethyl-6-methyl-2-(methylsulfanylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 62693645 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 5-ethyl-6-methyl-2-(methylsulfanylmethyl)pyrimidin-4-amine |
| SMILES | CCc1c(C)nc(CSC)nc1N |
| InChI | InChI=1S/C9H15N3S/c1-4-7-6(2)11-8(5-13-3)12-9(7)10/h4-5H2,1-3H3,(H2,10,11,12) |
| InChIKey | DVJQXQBSYGALTC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |