C9H16N4 — CID 62693871
4-(4-methyl-1,2,4-triazol-3-yl)cyclohexan-1-amine (PubChem CID 62693871) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-(4-methyl-1,2,4-triazol-3-yl)cyclohexan-1-amine.
| Compound Name | 4-(4-methyl-1,2,4-triazol-3-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 62693871 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 4-(4-methyl-1,2,4-triazol-3-yl)cyclohexan-1-amine |
| SMILES | Cn1cnnc1C1CCC(N)CC1 |
| InChI | InChI=1S/C9H16N4/c1-13-6-11-12-9(13)7-2-4-8(10)5-3-7/h6-8H,2-5,10H2,1H3 |
| InChIKey | OTQLNKFKXGCRAS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |