About 3-(2-methylbutylamino)-2,3-dihydro-1-benzofuran-6-ol
3-(2-methylbutylamino)-2,3-dihydro-1-benzofuran-6-ol (PubChem CID 62693908) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-(2-methylbutylamino)-2,3-dihydro-1-benzofuran-6-ol.
Molecular Properties
| Compound Name | 3-(2-methylbutylamino)-2,3-dihydro-1-benzofuran-6-ol |
| PubChem CID | 62693908 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 3-(2-methylbutylamino)-2,3-dihydro-1-benzofuran-6-ol |
| SMILES | CCC(C)CNC1COc2cc(O)ccc21 |
| InChI | InChI=1S/C13H19NO2/c1-3-9(2)7-14-12-8-16-13-6-10(15)4-5-11(12)13/h4-6,9,12,14-15H,3,7-8H2,1-2H3 |
| InChIKey | XZKFGOKGEWXBHS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-methylbutylamino)-2,3-dihydro-1-benzofuran-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylbutylamino)-2,3-dihydro-1-benzofuran-6-ol?
The IUPAC name of 3-(2-methylbutylamino)-2,3-dihydro-1-benzofuran-6-ol (CID 62693908) is 3-(2-methylbutylamino)-2,3-dihydro-1-benzofuran-6-ol.
What is the SMILES notation for 3-(2-methylbutylamino)-2,3-dihydro-1-benzofuran-6-ol?
The canonical SMILES for 3-(2-methylbutylamino)-2,3-dihydro-1-benzofuran-6-ol is CCC(C)CNC1COc2cc(O)ccc21.
What is the InChIKey of 3-(2-methylbutylamino)-2,3-dihydro-1-benzofuran-6-ol?
The InChIKey is XZKFGOKGEWXBHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-3-9(2)7-14-12-8-16-13-6-10(15)4-5-11(12)13/h4-6,9,12,14-15H,3,7-8H2,1-2H3.
What are the key properties of 3-(2-methylbutylamino)-2,3-dihydro-1-benzofuran-6-ol?
3-(2-methylbutylamino)-2,3-dihydro-1-benzofuran-6-ol has a molecular weight of 221.30 g/mol, XLogP of 2.46, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylbutylamino)-2,3-dihydro-1-benzofuran-6-ol is sourced from PubChem (CID 62693908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).