C17H17ClF2N2O2 — CID 626963
1-[4-[chloro(difluoro)methoxy]phenyl]-3,6,6-trimethyl-5,7-dihydroindazol-4-one (PubChem CID 626963) has the molecular formula C17H17ClF2N2O2 and a molecular weight of 354.78 g/mol. Its IUPAC name is 1-[4-[chloro(difluoro)methoxy]phenyl]-3,6,6-trimethyl-5,7-dihydroindazol-4-one.
| Compound Name | 1-[4-[chloro(difluoro)methoxy]phenyl]-3,6,6-trimethyl-5,7-dihydroindazol-4-one |
|---|---|
| PubChem CID | 626963 |
| Molecular Formula | C17H17ClF2N2O2 |
| Molecular Weight | 354.78 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 1-[4-[chloro(difluoro)methoxy]phenyl]-3,6,6-trimethyl-5,7-dihydroindazol-4-one |
| SMILES | Cc1nn(-c2ccc(OC(F)(F)Cl)cc2)c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C17H17ClF2N2O2/c1-10-15-13(8-16(2,3)9-14(15)23)22(21-10)11-4-6-12(7-5-11)24-17(18,19)20/h4-7H,8-9H2,1-3H3 |
| InChIKey | UVGGKMOITILRQQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.78 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|