C10H16N2O5 — CID 62696389
2-cyclopropyl-2-[[2-(ethoxycarbonylamino)-2-oxoethyl]amino]acetic acid (PubChem CID 62696389) has the molecular formula C10H16N2O5 and a molecular weight of 244.25 g/mol. Its IUPAC name is 2-cyclopropyl-2-[[2-(ethoxycarbonylamino)-2-oxoethyl]amino]acetic acid.
| Compound Name | 2-cyclopropyl-2-[[2-(ethoxycarbonylamino)-2-oxoethyl]amino]acetic acid |
|---|---|
| PubChem CID | 62696389 |
| Molecular Formula | C10H16N2O5 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 2-cyclopropyl-2-[[2-(ethoxycarbonylamino)-2-oxoethyl]amino]acetic acid |
| SMILES | CCOC(=O)NC(=O)CNC(C(=O)O)C1CC1 |
| InChI | InChI=1S/C10H16N2O5/c1-2-17-10(16)12-7(13)5-11-8(9(14)15)6-3-4-6/h6,8,11H,2-5H2,1H3,(H,14,15)(H,12,13,16) |
| InChIKey | XBRPTNJCEPVKGI-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |