About 3-methyl-4-(4-propan-2-yl-1,2,4-triazol-3-yl)aniline
3-methyl-4-(4-propan-2-yl-1,2,4-triazol-3-yl)aniline (PubChem CID 62697003) has the molecular formula C12H16N4
and a molecular weight of 216.29 g/mol. Its IUPAC name is 3-methyl-4-(4-propan-2-yl-1,2,4-triazol-3-yl)aniline.
Molecular Properties
| Compound Name | 3-methyl-4-(4-propan-2-yl-1,2,4-triazol-3-yl)aniline |
| PubChem CID | 62697003 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 3-methyl-4-(4-propan-2-yl-1,2,4-triazol-3-yl)aniline |
| SMILES | Cc1cc(N)ccc1-c1nncn1C(C)C |
| InChI | InChI=1S/C12H16N4/c1-8(2)16-7-14-15-12(16)11-5-4-10(13)6-9(11)3/h4-8H,13H2,1-3H3 |
| InChIKey | RDWGFDKKFVBBAT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-4-(4-propan-2-yl-1,2,4-triazol-3-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-(4-propan-2-yl-1,2,4-triazol-3-yl)aniline?
The IUPAC name of 3-methyl-4-(4-propan-2-yl-1,2,4-triazol-3-yl)aniline (CID 62697003) is 3-methyl-4-(4-propan-2-yl-1,2,4-triazol-3-yl)aniline.
What is the SMILES notation for 3-methyl-4-(4-propan-2-yl-1,2,4-triazol-3-yl)aniline?
The canonical SMILES for 3-methyl-4-(4-propan-2-yl-1,2,4-triazol-3-yl)aniline is Cc1cc(N)ccc1-c1nncn1C(C)C.
What is the InChIKey of 3-methyl-4-(4-propan-2-yl-1,2,4-triazol-3-yl)aniline?
The InChIKey is RDWGFDKKFVBBAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4/c1-8(2)16-7-14-15-12(16)11-5-4-10(13)6-9(11)3/h4-8H,13H2,1-3H3.
What are the key properties of 3-methyl-4-(4-propan-2-yl-1,2,4-triazol-3-yl)aniline?
3-methyl-4-(4-propan-2-yl-1,2,4-triazol-3-yl)aniline has a molecular weight of 216.29 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-(4-propan-2-yl-1,2,4-triazol-3-yl)aniline is sourced from PubChem (CID 62697003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).