About 5-(4-cyclopropyl-1,2,4-triazol-3-yl)pentanoic acid
5-(4-cyclopropyl-1,2,4-triazol-3-yl)pentanoic acid (PubChem CID 62697010) has the molecular formula C10H15N3O2
and a molecular weight of 209.25 g/mol. Its IUPAC name is 5-(4-cyclopropyl-1,2,4-triazol-3-yl)pentanoic acid.
Molecular Properties
| Compound Name | 5-(4-cyclopropyl-1,2,4-triazol-3-yl)pentanoic acid |
| PubChem CID | 62697010 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 5-(4-cyclopropyl-1,2,4-triazol-3-yl)pentanoic acid |
| SMILES | O=C(O)CCCCc1nncn1C1CC1 |
| InChI | InChI=1S/C10H15N3O2/c14-10(15)4-2-1-3-9-12-11-7-13(9)8-5-6-8/h7-8H,1-6H2,(H,14,15) |
| InChIKey | BLUGNRQQHABWSJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-cyclopropyl-1,2,4-triazol-3-yl)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-cyclopropyl-1,2,4-triazol-3-yl)pentanoic acid?
The IUPAC name of 5-(4-cyclopropyl-1,2,4-triazol-3-yl)pentanoic acid (CID 62697010) is 5-(4-cyclopropyl-1,2,4-triazol-3-yl)pentanoic acid.
What is the SMILES notation for 5-(4-cyclopropyl-1,2,4-triazol-3-yl)pentanoic acid?
The canonical SMILES for 5-(4-cyclopropyl-1,2,4-triazol-3-yl)pentanoic acid is O=C(O)CCCCc1nncn1C1CC1.
What is the InChIKey of 5-(4-cyclopropyl-1,2,4-triazol-3-yl)pentanoic acid?
The InChIKey is BLUGNRQQHABWSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2/c14-10(15)4-2-1-3-9-12-11-7-13(9)8-5-6-8/h7-8H,1-6H2,(H,14,15).
What are the key properties of 5-(4-cyclopropyl-1,2,4-triazol-3-yl)pentanoic acid?
5-(4-cyclopropyl-1,2,4-triazol-3-yl)pentanoic acid has a molecular weight of 209.25 g/mol, XLogP of 1.41, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-cyclopropyl-1,2,4-triazol-3-yl)pentanoic acid is sourced from PubChem (CID 62697010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).