About 2-amino-5-(2-ethyl-1,2,4-triazol-3-yl)phenol
2-amino-5-(2-ethyl-1,2,4-triazol-3-yl)phenol (PubChem CID 62697211) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-amino-5-(2-ethyl-1,2,4-triazol-3-yl)phenol.
Molecular Properties
| Compound Name | 2-amino-5-(2-ethyl-1,2,4-triazol-3-yl)phenol |
| PubChem CID | 62697211 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2-amino-5-(2-ethyl-1,2,4-triazol-3-yl)phenol |
| SMILES | CCn1ncnc1-c1ccc(N)c(O)c1 |
| InChI | InChI=1S/C10H12N4O/c1-2-14-10(12-6-13-14)7-3-4-8(11)9(15)5-7/h3-6,15H,2,11H2,1H3 |
| InChIKey | QMNDDTIAAMXNQK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-(2-ethyl-1,2,4-triazol-3-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-(2-ethyl-1,2,4-triazol-3-yl)phenol?
The IUPAC name of 2-amino-5-(2-ethyl-1,2,4-triazol-3-yl)phenol (CID 62697211) is 2-amino-5-(2-ethyl-1,2,4-triazol-3-yl)phenol.
What is the SMILES notation for 2-amino-5-(2-ethyl-1,2,4-triazol-3-yl)phenol?
The canonical SMILES for 2-amino-5-(2-ethyl-1,2,4-triazol-3-yl)phenol is CCn1ncnc1-c1ccc(N)c(O)c1.
What is the InChIKey of 2-amino-5-(2-ethyl-1,2,4-triazol-3-yl)phenol?
The InChIKey is QMNDDTIAAMXNQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O/c1-2-14-10(12-6-13-14)7-3-4-8(11)9(15)5-7/h3-6,15H,2,11H2,1H3.
What are the key properties of 2-amino-5-(2-ethyl-1,2,4-triazol-3-yl)phenol?
2-amino-5-(2-ethyl-1,2,4-triazol-3-yl)phenol has a molecular weight of 204.23 g/mol, XLogP of 1.25, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-(2-ethyl-1,2,4-triazol-3-yl)phenol is sourced from PubChem (CID 62697211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).