C11H15N3O — CID 62698146
1-(4-amino-2-methylphenyl)-3-cyclopropylurea (PubChem CID 62698146) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-(4-amino-2-methylphenyl)-3-cyclopropylurea.
| Compound Name | 1-(4-amino-2-methylphenyl)-3-cyclopropylurea |
|---|---|
| PubChem CID | 62698146 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 1-(4-amino-2-methylphenyl)-3-cyclopropylurea |
| SMILES | Cc1cc(N)ccc1NC(=O)NC1CC1 |
| InChI | InChI=1S/C11H15N3O/c1-7-6-8(12)2-5-10(7)14-11(15)13-9-3-4-9/h2,5-6,9H,3-4,12H2,1H3,(H2,13,14,15) |
| InChIKey | VLOIGVYMZNNBPP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|