C10H18N4 — CID 62698388
N'-ethyl-N'-(pyrimidin-2-ylmethyl)propane-1,3-diamine (PubChem CID 62698388) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is N'-ethyl-N'-(pyrimidin-2-ylmethyl)propane-1,3-diamine.
| Compound Name | N'-ethyl-N'-(pyrimidin-2-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 62698388 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | N'-ethyl-N'-(pyrimidin-2-ylmethyl)propane-1,3-diamine |
| SMILES | CCN(CCCN)Cc1ncccn1 |
| InChI | InChI=1S/C10H18N4/c1-2-14(8-3-5-11)9-10-12-6-4-7-13-10/h4,6-7H,2-3,5,8-9,11H2,1H3 |
| InChIKey | LBAYMPVHQBLXSU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |