C13H13N3OS — CID 62699465
2-(furan-2-yl)-N,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 62699465) has the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-(furan-2-yl)-N,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-(furan-2-yl)-N,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 62699465 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-(furan-2-yl)-N,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CNc1nc(-c2ccco2)nc2sc(C)c(C)c12 |
| InChI | InChI=1S/C13H13N3OS/c1-7-8(2)18-13-10(7)12(14-3)15-11(16-13)9-5-4-6-17-9/h4-6H,1-3H3,(H,14,15,16) |
| InChIKey | FPKRXRXRFDZSLQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |