C13H12N2O2 — CID 62699680
2-cyclopropyl-3a,4-dihydroimidazo[1,5-a]indole-1,3-dione (PubChem CID 62699680) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-cyclopropyl-3a,4-dihydroimidazo[1,5-a]indole-1,3-dione.
| Compound Name | 2-cyclopropyl-3a,4-dihydroimidazo[1,5-a]indole-1,3-dione |
|---|---|
| PubChem CID | 62699680 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-cyclopropyl-3a,4-dihydroimidazo[1,5-a]indole-1,3-dione |
| SMILES | O=C1C2Cc3ccccc3N2C(=O)N1C1CC1 |
| InChI | InChI=1S/C13H12N2O2/c16-12-11-7-8-3-1-2-4-10(8)15(11)13(17)14(12)9-5-6-9/h1-4,9,11H,5-7H2 |
| InChIKey | SDIJRTWQMJQCCY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|