C11H21N3O — CID 62699859
3-cyclopropyl-1-propyl-1-pyrrolidin-3-ylurea (PubChem CID 62699859) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 3-cyclopropyl-1-propyl-1-pyrrolidin-3-ylurea.
| Compound Name | 3-cyclopropyl-1-propyl-1-pyrrolidin-3-ylurea |
|---|---|
| PubChem CID | 62699859 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 3-cyclopropyl-1-propyl-1-pyrrolidin-3-ylurea |
| SMILES | CCCN(C(=O)NC1CC1)C1CCNC1 |
| InChI | InChI=1S/C11H21N3O/c1-2-7-14(10-5-6-12-8-10)11(15)13-9-3-4-9/h9-10,12H,2-8H2,1H3,(H,13,15) |
| InChIKey | ZFXONETUEWZOND-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |